C10H20N6O2 — CID 106412597
1-amino-2-(3-ethoxypropyl)-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine (PubChem CID 106412597) has the molecular formula C10H20N6O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is 1-amino-2-(3-ethoxypropyl)-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine.
| Compound Name | 1-amino-2-(3-ethoxypropyl)-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 106412597 |
| Molecular Formula | C10H20N6O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 1-amino-2-(3-ethoxypropyl)-3-[2-(1,2,4-oxadiazol-5-yl)ethyl]guanidine |
| SMILES | CCOCCC/N=C(\NN)NCCc1ncno1 |
| InChI | InChI=1S/C10H20N6O2/c1-2-17-7-3-5-12-10(16-11)13-6-4-9-14-8-15-18-9/h8H,2-7,11H2,1H3,(H2,12,13,16) |
| InChIKey | WLAMZYRXMRZWEA-UHFFFAOYSA-N |
| XLogP | -0.55 |
| TPSA | 110.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|