C22H35NO2 — CID 10641273
(8S,10R,13S,14S)-10-[2-(dimethylamino)ethyl]-13-methyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 10641273) has the molecular formula C22H35NO2 and a molecular weight of 345.53 g/mol. Its IUPAC name is (8S,10R,13S,14S)-10-[2-(dimethylamino)ethyl]-13-methyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,10R,13S,14S)-10-[2-(dimethylamino)ethyl]-13-methyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 10641273 |
| Molecular Formula | C22H35NO2 |
| Molecular Weight | 345.53 g/mol |
| Exact Mass | 345.27 |
| IUPAC Name | (8S,10R,13S,14S)-10-[2-(dimethylamino)ethyl]-13-methyl-2,3,6,7,8,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CN(C)CC[C@]12CCC(O)C=C1CC[C@@H]1C2=CC[C@]2(C)C(O)CC[C@@H]12 |
| InChI | InChI=1S/C22H35NO2/c1-21-10-9-19-17(18(21)6-7-20(21)25)5-4-15-14-16(24)8-11-22(15,19)12-13-23(2)3/h9,14,16-18,20,24-25H,4-8,10-13H2,1-3H3/t16?,17-,18-,20?,21-,22+/m0/s1 |
| InChIKey | PZHLSPVFBHEJAR-AHJXNYHXSA-N |
| XLogP | 3.52 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.53 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|