C12H13N3O2 — CID 106414616
1-[2-amino-4-(1,2-oxazol-5-ylmethylamino)phenyl]ethanone (PubChem CID 106414616) has the molecular formula C12H13N3O2 and a molecular weight of 231.26 g/mol. Its IUPAC name is 1-[2-amino-4-(1,2-oxazol-5-ylmethylamino)phenyl]ethanone.
| Compound Name | 1-[2-amino-4-(1,2-oxazol-5-ylmethylamino)phenyl]ethanone |
|---|---|
| PubChem CID | 106414616 |
| Molecular Formula | C12H13N3O2 |
| Molecular Weight | 231.26 g/mol |
| Exact Mass | 231.10 |
| IUPAC Name | 1-[2-amino-4-(1,2-oxazol-5-ylmethylamino)phenyl]ethanone |
| SMILES | CC(=O)c1ccc(NCc2ccno2)cc1N |
| InChI | InChI=1S/C12H13N3O2/c1-8(16)11-3-2-9(6-12(11)13)14-7-10-4-5-15-17-10/h2-6,14H,7,13H2,1H3 |
| InChIKey | NTEATOBLFXUJRT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|