C11H13F3N2O2 — CID 114092979
1-[2-amino-4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]phenyl]ethanone (PubChem CID 114092979) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is 1-[2-amino-4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]phenyl]ethanone.
| Compound Name | 1-[2-amino-4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]phenyl]ethanone |
|---|---|
| PubChem CID | 114092979 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-[2-amino-4-[(3,3,3-trifluoro-2-hydroxypropyl)amino]phenyl]ethanone |
| SMILES | CC(=O)c1ccc(NCC(O)C(F)(F)F)cc1N |
| InChI | InChI=1S/C11H13F3N2O2/c1-6(17)8-3-2-7(4-9(8)15)16-5-10(18)11(12,13)14/h2-4,10,16,18H,5,15H2,1H3 |
| InChIKey | OCVFBFCHPCBBBM-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|