C20H33NO2S — CID 10641698
trans-methyl (1R,2S)-1-(5-methylhex-4-enyl)-2-(2-pyrrolidin-1-yl-2-sulfanylideneethyl)cyclopentane-1-carboxylate (PubChem CID 10641698) has the molecular formula C20H33NO2S and a molecular weight of 351.56 g/mol. Its IUPAC name is trans-methyl (1R,2S)-1-(5-methylhex-4-enyl)-2-(2-pyrrolidin-1-yl-2-sulfanylideneethyl)cyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1R,2S)-1-(5-methylhex-4-enyl)-2-(2-pyrrolidin-1-yl-2-sulfanylideneethyl)cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10641698 |
| Molecular Formula | C20H33NO2S |
| Molecular Weight | 351.56 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | trans-methyl (1R,2S)-1-(5-methylhex-4-enyl)-2-(2-pyrrolidin-1-yl-2-sulfanylideneethyl)cyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(CCCC=C(C)C)CCC[C@H]1CC(=S)N1CCCC1 |
| InChI | InChI=1S/C20H33NO2S/c1-16(2)9-4-5-11-20(19(22)23-3)12-8-10-17(20)15-18(24)21-13-6-7-14-21/h9,17H,4-8,10-15H2,1-3H3/t17-,20-/m0/s1 |
| InChIKey | CUACXAWKVFNJEJ-PXNSSMCTSA-N |
| XLogP | 4.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|