C21H35NO3 — CID 10760260
trans-methyl (1R,2S)-1-(5-methylhex-4-enyl)-2-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]cyclopentane-1-carboxylate (PubChem CID 10760260) has the molecular formula C21H35NO3 and a molecular weight of 349.52 g/mol. Its IUPAC name is trans-methyl (1R,2S)-1-(5-methylhex-4-enyl)-2-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]cyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1R,2S)-1-(5-methylhex-4-enyl)-2-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10760260 |
| Molecular Formula | C21H35NO3 |
| Molecular Weight | 349.52 g/mol |
| Exact Mass | 349.26 |
| IUPAC Name | trans-methyl (1R,2S)-1-(5-methylhex-4-enyl)-2-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)[C@@]1(CCCC=C(C)C)CCC[C@H]1[C@H](C)C(=O)N1CCCC1 |
| InChI | InChI=1S/C21H35NO3/c1-16(2)10-5-6-12-21(20(24)25-4)13-9-11-18(21)17(3)19(23)22-14-7-8-15-22/h10,17-18H,5-9,11-15H2,1-4H3/t17-,18-,21-/m0/s1 |
| InChIKey | PCZAEJXLRUFSHY-WFXMLNOXSA-N |
| XLogP | 4.34 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|