C20H35NO2 — CID 10496025
(2S)-2-[(1S,2R)-2-(hydroxymethyl)-2-(5-methylhex-4-enyl)cyclopentyl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 10496025) has the molecular formula C20H35NO2 and a molecular weight of 321.50 g/mol. Its IUPAC name is (2S)-2-[(1S,2R)-2-(hydroxymethyl)-2-(5-methylhex-4-enyl)cyclopentyl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | (2S)-2-[(1S,2R)-2-(hydroxymethyl)-2-(5-methylhex-4-enyl)cyclopentyl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 10496025 |
| Molecular Formula | C20H35NO2 |
| Molecular Weight | 321.50 g/mol |
| Exact Mass | 321.27 |
| IUPAC Name | (2S)-2-[(1S,2R)-2-(hydroxymethyl)-2-(5-methylhex-4-enyl)cyclopentyl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | CC(C)=CCCC[C@]1(CO)CCC[C@H]1[C@H](C)C(=O)N1CCCC1 |
| InChI | InChI=1S/C20H35NO2/c1-16(2)9-4-5-11-20(15-22)12-8-10-18(20)17(3)19(23)21-13-6-7-14-21/h9,17-18,22H,4-8,10-15H2,1-3H3/t17-,18-,20+/m0/s1 |
| InChIKey | LPQQQNSXOSCDCQ-CMKODMSKSA-N |
| XLogP | 4.16 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|