C18H31NO2 — CID 10685152
(2S)-2-[(1S,2S)-2-(hydroxymethyl)-2-pent-4-enylcyclopentyl]-1-pyrrolidin-1-ylpropan-1-one (PubChem CID 10685152) has the molecular formula C18H31NO2 and a molecular weight of 293.45 g/mol. Its IUPAC name is (2S)-2-[(1S,2S)-2-(hydroxymethyl)-2-pent-4-enylcyclopentyl]-1-pyrrolidin-1-ylpropan-1-one.
| Compound Name | (2S)-2-[(1S,2S)-2-(hydroxymethyl)-2-pent-4-enylcyclopentyl]-1-pyrrolidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 10685152 |
| Molecular Formula | C18H31NO2 |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.24 |
| IUPAC Name | (2S)-2-[(1S,2S)-2-(hydroxymethyl)-2-pent-4-enylcyclopentyl]-1-pyrrolidin-1-ylpropan-1-one |
| SMILES | C=CCCC[C@]1(CO)CCC[C@H]1[C@H](C)C(=O)N1CCCC1 |
| InChI | InChI=1S/C18H31NO2/c1-3-4-5-10-18(14-20)11-8-9-16(18)15(2)17(21)19-12-6-7-13-19/h3,15-16,20H,1,4-14H2,2H3/t15-,16-,18+/m0/s1 |
| InChIKey | RPTMUXXITMGDPZ-XYJFISCASA-N |
| XLogP | 3.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|