C19H31NO3 — CID 10591880
trans-methyl (1S,2S)-2-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-1-pent-4-enylcyclopentane-1-carboxylate (PubChem CID 10591880) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is trans-methyl (1S,2S)-2-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-1-pent-4-enylcyclopentane-1-carboxylate.
| Compound Name | trans-methyl (1S,2S)-2-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-1-pent-4-enylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10591880 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | trans-methyl (1S,2S)-2-[(2S)-1-oxo-1-pyrrolidin-1-ylpropan-2-yl]-1-pent-4-enylcyclopentane-1-carboxylate |
| SMILES | C=CCCC[C@]1(C(=O)OC)CCC[C@H]1[C@H](C)C(=O)N1CCCC1 |
| InChI | InChI=1S/C19H31NO3/c1-4-5-6-11-19(18(22)23-3)12-9-10-16(19)15(2)17(21)20-13-7-8-14-20/h4,15-16H,1,5-14H2,2-3H3/t15-,16-,19-/m0/s1 |
| InChIKey | COCXYEXBAPMIBW-BXWFABGCSA-N |
| XLogP | 3.56 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|