C11H17N3O4 — CID 106421211
(2S)-2-(1,2-oxazol-5-ylmethylcarbamoylamino)hexanoic acid (PubChem CID 106421211) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is (2S)-2-(1,2-oxazol-5-ylmethylcarbamoylamino)hexanoic acid.
| Compound Name | (2S)-2-(1,2-oxazol-5-ylmethylcarbamoylamino)hexanoic acid |
|---|---|
| PubChem CID | 106421211 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | (2S)-2-(1,2-oxazol-5-ylmethylcarbamoylamino)hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)NCc1ccno1)C(=O)O |
| InChI | InChI=1S/C11H17N3O4/c1-2-3-4-9(10(15)16)14-11(17)12-7-8-5-6-13-18-8/h5-6,9H,2-4,7H2,1H3,(H,15,16)(H2,12,14,17)/t9-/m0/s1 |
| InChIKey | QBFULZACSXWZEW-VIFPVBQESA-N |
| XLogP | 1.12 |
| TPSA | 104.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |