About 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide
2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide (PubChem CID 106423091) has the molecular formula C15H20N4O2
and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide.
Molecular Properties
| Compound Name | 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide |
| PubChem CID | 106423091 |
| Molecular Formula | C15H20N4O2 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide |
| SMILES | CCCNc1cc(C(=O)NCc2ccno2)cc(CC)n1 |
| InChI | InChI=1S/C15H20N4O2/c1-3-6-16-14-9-11(8-12(4-2)19-14)15(20)17-10-13-5-7-18-21-13/h5,7-9H,3-4,6,10H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | UXOUFODQFONSOT-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide?
The IUPAC name of 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide (CID 106423091) is 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide.
What is the SMILES notation for 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide?
The canonical SMILES for 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide is CCCNc1cc(C(=O)NCc2ccno2)cc(CC)n1.
What is the InChIKey of 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide?
The InChIKey is UXOUFODQFONSOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N4O2/c1-3-6-16-14-9-11(8-12(4-2)19-14)15(20)17-10-13-5-7-18-21-13/h5,7-9H,3-4,6,10H2,1-2H3,(H,16,19)(H,17,20).
What are the key properties of 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide?
2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide has a molecular weight of 288.35 g/mol, XLogP of 2.38, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-N-(1,2-oxazol-5-ylmethyl)-6-(propylamino)pyridine-4-carboxamide is sourced from PubChem (CID 106423091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).