C17H20N2O5S — CID 10642533
(2S)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxypropanamide (PubChem CID 10642533) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is (2S)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxypropanamide.
| Compound Name | (2S)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxypropanamide |
|---|---|
| PubChem CID | 10642533 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | (2S)-2-[benzyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxypropanamide |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)[C@@H](C)C(=O)NO)cc1 |
| InChI | InChI=1S/C17H20N2O5S/c1-13(17(20)18-21)19(12-14-6-4-3-5-7-14)25(22,23)16-10-8-15(24-2)9-11-16/h3-11,13,21H,12H2,1-2H3,(H,18,20)/t13-/m0/s1 |
| InChIKey | JRCGNOYYZQLNTH-ZDUSSCGKSA-N |
| XLogP | 1.78 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|