C16H17ClN2O5S — CID 9843079
2-{[(4-chlorophenyl)methyl](4-methoxybenzene)sulfonamido}-N-hydroxyacetamide (PubChem CID 9843079) has the molecular formula C16H17ClN2O5S and a molecular weight of 384.80 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)methyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxyacetamide.
| Compound Name | 2-{[(4-chlorophenyl)methyl](4-methoxybenzene)sulfonamido}-N-hydroxyacetamide |
|---|---|
| PubChem CID | 9843079 |
| Molecular Formula | C16H17ClN2O5S |
| Molecular Weight | 384.80 g/mol |
| Exact Mass | 384.05 |
| IUPAC Name | 2-[(4-chlorophenyl)methyl-(4-methoxyphenyl)sulfonylamino]-N-hydroxyacetamide |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)N(CC2=CC=C(C=C2)Cl)CC(=O)NO |
| InChI | InChI=1S/C16H17ClN2O5S/c1-24-14-6-8-15(9-7-14)25(22,23)19(11-16(20)18-21)10-12-2-4-13(17)5-3-12/h2-9,21H,10-11H2,1H3,(H,18,20) |
| InChIKey | HBPRCALADDGDIK-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 104.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | 523 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.80 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|