C8H15F2NS — CID 106425391
1,1-difluoro-N-(2-prop-2-enylsulfanylethyl)propan-2-amine (PubChem CID 106425391) has the molecular formula C8H15F2NS and a molecular weight of 195.28 g/mol. Its IUPAC name is 1,1-difluoro-N-(2-prop-2-enylsulfanylethyl)propan-2-amine.
| Compound Name | 1,1-difluoro-N-(2-prop-2-enylsulfanylethyl)propan-2-amine |
|---|---|
| PubChem CID | 106425391 |
| Molecular Formula | C8H15F2NS |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | 1,1-difluoro-N-(2-prop-2-enylsulfanylethyl)propan-2-amine |
| SMILES | C=CCSCCNC(C)C(F)F |
| InChI | InChI=1S/C8H15F2NS/c1-3-5-12-6-4-11-7(2)8(9)10/h3,7-8,11H,1,4-6H2,2H3 |
| InChIKey | FAASQPLEQKSEMD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|