C7H13F2NS — CID 106427794
2,2-difluoro-N-(2-prop-2-enylsulfanylethyl)ethanamine (PubChem CID 106427794) has the molecular formula C7H13F2NS and a molecular weight of 181.25 g/mol. Its IUPAC name is 2,2-difluoro-N-(2-prop-2-enylsulfanylethyl)ethanamine.
| Compound Name | 2,2-difluoro-N-(2-prop-2-enylsulfanylethyl)ethanamine |
|---|---|
| PubChem CID | 106427794 |
| Molecular Formula | C7H13F2NS |
| Molecular Weight | 181.25 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2,2-difluoro-N-(2-prop-2-enylsulfanylethyl)ethanamine |
| SMILES | C=CCSCCNCC(F)F |
| InChI | InChI=1S/C7H13F2NS/c1-2-4-11-5-3-10-6-7(8)9/h2,7,10H,1,3-6H2 |
| InChIKey | VAEBGIJQAPNYQL-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.25 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|