About 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate
1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate (PubChem CID 10642570) has the molecular formula C16H19N3O7
and a molecular weight of 365.34 g/mol. Its IUPAC name is 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate |
| PubChem CID | 10642570 |
| Molecular Formula | C16H19N3O7 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate |
| SMILES | CCOC(=O)/C(=C(\C)NN)C(C(=O)C(=O)OC)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H19N3O7/c1-4-26-15(21)12(9(2)18-17)13(14(20)16(22)25-3)10-7-5-6-8-11(10)19(23)24/h5-8,13,18H,4,17H2,1-3H3/b12-9+ |
| InChIKey | LYQDWHHNGJCJSN-FMIVXFBMSA-N |
| XLogP | 0.72 |
| TPSA | 150.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate?
The IUPAC name of 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate (CID 10642570) is 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate.
What is the SMILES notation for 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate?
The canonical SMILES for 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate is CCOC(=O)/C(=C(\C)NN)C(C(=O)C(=O)OC)c1ccccc1[N+](=O)[O-].
What is the InChIKey of 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate?
The InChIKey is LYQDWHHNGJCJSN-FMIVXFBMSA-N. The full InChI is InChI=1S/C16H19N3O7/c1-4-26-15(21)12(9(2)18-17)13(14(20)16(22)25-3)10-7-5-6-8-11(10)19(23)24/h5-8,13,18H,4,17H2,1-3H3/b12-9+.
What are the key properties of 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate?
1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate has a molecular weight of 365.34 g/mol, XLogP of 0.72, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 5-O-methyl (2E)-2-(1-hydrazinylethylidene)-3-(2-nitrophenyl)-4-oxopentanedioate is sourced from PubChem (CID 10642570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).