C8H18N2S — CID 106425794
2-N-(2-prop-2-enylsulfanylethyl)propane-1,2-diamine (PubChem CID 106425794) has the molecular formula C8H18N2S and a molecular weight of 174.31 g/mol. Its IUPAC name is 2-N-(2-prop-2-enylsulfanylethyl)propane-1,2-diamine.
| Compound Name | 2-N-(2-prop-2-enylsulfanylethyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 106425794 |
| Molecular Formula | C8H18N2S |
| Molecular Weight | 174.31 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | 2-N-(2-prop-2-enylsulfanylethyl)propane-1,2-diamine |
| SMILES | C=CCSCCNC(C)CN |
| InChI | InChI=1S/C8H18N2S/c1-3-5-11-6-4-10-8(2)7-9/h3,8,10H,1,4-7,9H2,2H3 |
| InChIKey | CSPNXYIXDXZXRL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.31 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|