C11H19NO3S — CID 106426614
3-methyl-5-oxo-5-(2-prop-2-enylsulfanylethylamino)pentanoic acid (PubChem CID 106426614) has the molecular formula C11H19NO3S and a molecular weight of 245.34 g/mol. Its IUPAC name is 3-methyl-5-oxo-5-(2-prop-2-enylsulfanylethylamino)pentanoic acid.
| Compound Name | 3-methyl-5-oxo-5-(2-prop-2-enylsulfanylethylamino)pentanoic acid |
|---|---|
| PubChem CID | 106426614 |
| Molecular Formula | C11H19NO3S |
| Molecular Weight | 245.34 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 3-methyl-5-oxo-5-(2-prop-2-enylsulfanylethylamino)pentanoic acid |
| SMILES | C=CCSCCNC(=O)CC(C)CC(=O)O |
| InChI | InChI=1S/C11H19NO3S/c1-3-5-16-6-4-12-10(13)7-9(2)8-11(14)15/h3,9H,1,4-8H2,2H3,(H,12,13)(H,14,15) |
| InChIKey | YEVMVUSWXGOUOS-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|