C9H14BrNOS — CID 106427093
2-bromo-N-(2-prop-2-ynylsulfanylethyl)butanamide (PubChem CID 106427093) has the molecular formula C9H14BrNOS and a molecular weight of 264.19 g/mol. Its IUPAC name is 2-bromo-N-(2-prop-2-ynylsulfanylethyl)butanamide.
| Compound Name | 2-bromo-N-(2-prop-2-ynylsulfanylethyl)butanamide |
|---|---|
| PubChem CID | 106427093 |
| Molecular Formula | C9H14BrNOS |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 263.00 |
| IUPAC Name | 2-bromo-N-(2-prop-2-ynylsulfanylethyl)butanamide |
| SMILES | C#CCSCCNC(=O)C(Br)CC |
| InChI | InChI=1S/C9H14BrNOS/c1-3-6-13-7-5-11-9(12)8(10)4-2/h1,8H,4-7H2,2H3,(H,11,12) |
| InChIKey | WGRYEOCJWAMJSO-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|