C10H18N2OS — CID 106427911
2-methyl-3-(methylamino)-N-(2-prop-2-ynylsulfanylethyl)propanamide (PubChem CID 106427911) has the molecular formula C10H18N2OS and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-methyl-3-(methylamino)-N-(2-prop-2-ynylsulfanylethyl)propanamide.
| Compound Name | 2-methyl-3-(methylamino)-N-(2-prop-2-ynylsulfanylethyl)propanamide |
|---|---|
| PubChem CID | 106427911 |
| Molecular Formula | C10H18N2OS |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.11 |
| IUPAC Name | 2-methyl-3-(methylamino)-N-(2-prop-2-ynylsulfanylethyl)propanamide |
| SMILES | C#CCSCCNC(=O)C(C)CNC |
| InChI | InChI=1S/C10H18N2OS/c1-4-6-14-7-5-12-10(13)9(2)8-11-3/h1,9,11H,5-8H2,2-3H3,(H,12,13) |
| InChIKey | PGEJRKJDOASASJ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|