C7H12N2S2 — CID 131206851
1-methyl-3-(2-prop-2-ynylsulfanylethyl)thiourea (PubChem CID 131206851) has the molecular formula C7H12N2S2 and a molecular weight of 188.32 g/mol. Its IUPAC name is 1-methyl-3-(2-prop-2-ynylsulfanylethyl)thiourea.
| Compound Name | 1-methyl-3-(2-prop-2-ynylsulfanylethyl)thiourea |
|---|---|
| PubChem CID | 131206851 |
| Molecular Formula | C7H12N2S2 |
| Molecular Weight | 188.32 g/mol |
| Exact Mass | 188.04 |
| IUPAC Name | 1-methyl-3-(2-prop-2-ynylsulfanylethyl)thiourea |
| SMILES | C#CCSCCNC(=S)NC |
| InChI | InChI=1S/C7H12N2S2/c1-3-5-11-6-4-9-7(10)8-2/h1H,4-6H2,2H3,(H2,8,9,10) |
| InChIKey | LQFWAFKOKUAANP-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.32 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|