C13H23F3N2O2S — CID 106427113
tert-butyl 2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrrolidine-1-carboxylate (PubChem CID 106427113) has the molecular formula C13H23F3N2O2S and a molecular weight of 328.40 g/mol. Its IUPAC name is tert-butyl 2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 106427113 |
| Molecular Formula | C13H23F3N2O2S |
| Molecular Weight | 328.40 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | tert-butyl 2-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CNCCSC(F)(F)F |
| InChI | InChI=1S/C13H23F3N2O2S/c1-12(2,3)20-11(19)18-7-4-5-10(18)9-17-6-8-21-13(14,15)16/h10,17H,4-9H2,1-3H3 |
| InChIKey | YPNHJIDWFRBEBV-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|