C21H21NO5 — CID 10642717
dibenzyl (2S)-6-oxopiperidine-1,2-dicarboxylate (PubChem CID 10642717) has the molecular formula C21H21NO5 and a molecular weight of 367.40 g/mol. Its IUPAC name is dibenzyl (2S)-6-oxopiperidine-1,2-dicarboxylate.
| Compound Name | dibenzyl (2S)-6-oxopiperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10642717 |
| Molecular Formula | C21H21NO5 |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | dibenzyl (2S)-6-oxopiperidine-1,2-dicarboxylate |
| SMILES | O=C(OCc1ccccc1)[C@@H]1CCCC(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H21NO5/c23-19-13-7-12-18(20(24)26-14-16-8-3-1-4-9-16)22(19)21(25)27-15-17-10-5-2-6-11-17/h1-6,8-11,18H,7,12-15H2/t18-/m0/s1 |
| InChIKey | FEOZVDIRKGUJSC-SFHVURJKSA-N |
| XLogP | 3.45 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |