C15H19NO3 — CID 129268188
benzyl (2S)-1-ethyl-6-oxopiperidine-2-carboxylate (PubChem CID 129268188) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is benzyl (2S)-1-ethyl-6-oxopiperidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-ethyl-6-oxopiperidine-2-carboxylate |
|---|---|
| PubChem CID | 129268188 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | benzyl (2S)-1-ethyl-6-oxopiperidine-2-carboxylate |
| SMILES | CCN1C(=O)CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C15H19NO3/c1-2-16-13(9-6-10-14(16)17)15(18)19-11-12-7-4-3-5-8-12/h3-5,7-8,13H,2,6,9-11H2,1H3/t13-/m0/s1 |
| InChIKey | MLKNTNHHJHBOAE-ZDUSSCGKSA-N |
| XLogP | 2.13 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |