C13H17BrF3NOS — CID 106427185
N-[(5-bromo-2-propoxyphenyl)methyl]-2-(trifluoromethylsulfanyl)ethanamine (PubChem CID 106427185) has the molecular formula C13H17BrF3NOS and a molecular weight of 372.25 g/mol. Its IUPAC name is N-[(5-bromo-2-propoxyphenyl)methyl]-2-(trifluoromethylsulfanyl)ethanamine.
| Compound Name | N-[(5-bromo-2-propoxyphenyl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 106427185 |
| Molecular Formula | C13H17BrF3NOS |
| Molecular Weight | 372.25 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | N-[(5-bromo-2-propoxyphenyl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
| SMILES | CCCOc1ccc(Br)cc1CNCCSC(F)(F)F |
| InChI | InChI=1S/C13H17BrF3NOS/c1-2-6-19-12-4-3-11(14)8-10(12)9-18-5-7-20-13(15,16)17/h3-4,8,18H,2,5-7,9H2,1H3 |
| InChIKey | VJJQOFCKABNVLR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.25 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|