C15H24BrNOS — CID 115639267
N-[(5-bromo-2-propoxyphenyl)methyl]-4-methylsulfanylbutan-1-amine (PubChem CID 115639267) has the molecular formula C15H24BrNOS and a molecular weight of 346.33 g/mol. Its IUPAC name is N-[(5-bromo-2-propoxyphenyl)methyl]-4-methylsulfanylbutan-1-amine.
| Compound Name | N-[(5-bromo-2-propoxyphenyl)methyl]-4-methylsulfanylbutan-1-amine |
|---|---|
| PubChem CID | 115639267 |
| Molecular Formula | C15H24BrNOS |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-[(5-bromo-2-propoxyphenyl)methyl]-4-methylsulfanylbutan-1-amine |
| SMILES | CCCOc1ccc(Br)cc1CNCCCCSC |
| InChI | InChI=1S/C15H24BrNOS/c1-3-9-18-15-7-6-14(16)11-13(15)12-17-8-4-5-10-19-2/h6-7,11,17H,3-5,8-10,12H2,1-2H3 |
| InChIKey | JTQQMHSPEWRWLM-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|