C10H17N3OS — CID 106427808
N-(2-cyanoethyl)-2-(2-prop-2-enylsulfanylethylamino)acetamide (PubChem CID 106427808) has the molecular formula C10H17N3OS and a molecular weight of 227.33 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(2-prop-2-enylsulfanylethylamino)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(2-prop-2-enylsulfanylethylamino)acetamide |
|---|---|
| PubChem CID | 106427808 |
| Molecular Formula | C10H17N3OS |
| Molecular Weight | 227.33 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-(2-cyanoethyl)-2-(2-prop-2-enylsulfanylethylamino)acetamide |
| SMILES | C=CCSCCNCC(=O)NCCC#N |
| InChI | InChI=1S/C10H17N3OS/c1-2-7-15-8-6-12-9-10(14)13-5-3-4-11/h2,12H,1,3,5-9H2,(H,13,14) |
| InChIKey | JRYBVQYSUMEHOB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.33 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|