C8H15F3N2OS — CID 106428151
2-methyl-2-(methylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide (PubChem CID 106428151) has the molecular formula C8H15F3N2OS and a molecular weight of 244.28 g/mol. Its IUPAC name is 2-methyl-2-(methylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide.
| Compound Name | 2-methyl-2-(methylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide |
|---|---|
| PubChem CID | 106428151 |
| Molecular Formula | C8H15F3N2OS |
| Molecular Weight | 244.28 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | 2-methyl-2-(methylamino)-N-[2-(trifluoromethylsulfanyl)ethyl]propanamide |
| SMILES | CNC(C)(C)C(=O)NCCSC(F)(F)F |
| InChI | InChI=1S/C8H15F3N2OS/c1-7(2,12-3)6(14)13-4-5-15-8(9,10)11/h12H,4-5H2,1-3H3,(H,13,14) |
| InChIKey | WYKHWLHSMWOCLO-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|