C8H13NO2S — CID 106428536
3-(2-prop-2-ynylsulfanylethylamino)propanoic acid (PubChem CID 106428536) has the molecular formula C8H13NO2S and a molecular weight of 187.26 g/mol. Its IUPAC name is 3-(2-prop-2-ynylsulfanylethylamino)propanoic acid.
| Compound Name | 3-(2-prop-2-ynylsulfanylethylamino)propanoic acid |
|---|---|
| PubChem CID | 106428536 |
| Molecular Formula | C8H13NO2S |
| Molecular Weight | 187.26 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 3-(2-prop-2-ynylsulfanylethylamino)propanoic acid |
| SMILES | C#CCSCCNCCC(=O)O |
| InChI | InChI=1S/C8H13NO2S/c1-2-6-12-7-5-9-4-3-8(10)11/h1,9H,3-7H2,(H,10,11) |
| InChIKey | QCDSDNAPMDRTTR-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.26 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|