C9H15NO3S — CID 106429922
3-hydroxy-4-(2-prop-2-ynylsulfanylethylamino)butanoic acid (PubChem CID 106429922) has the molecular formula C9H15NO3S and a molecular weight of 217.29 g/mol. Its IUPAC name is 3-hydroxy-4-(2-prop-2-ynylsulfanylethylamino)butanoic acid.
| Compound Name | 3-hydroxy-4-(2-prop-2-ynylsulfanylethylamino)butanoic acid |
|---|---|
| PubChem CID | 106429922 |
| Molecular Formula | C9H15NO3S |
| Molecular Weight | 217.29 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 3-hydroxy-4-(2-prop-2-ynylsulfanylethylamino)butanoic acid |
| SMILES | C#CCSCCNCC(O)CC(=O)O |
| InChI | InChI=1S/C9H15NO3S/c1-2-4-14-5-3-10-7-8(11)6-9(12)13/h1,8,10-11H,3-7H2,(H,12,13) |
| InChIKey | KDPMUUFNDPPXCB-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.29 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|