C8H11Cl2NS — CID 106428542
(E)-2,3-dichloro-N-(2-prop-2-ynylsulfanylethyl)prop-2-en-1-amine (PubChem CID 106428542) has the molecular formula C8H11Cl2NS and a molecular weight of 224.16 g/mol. Its IUPAC name is (E)-2,3-dichloro-N-(2-prop-2-ynylsulfanylethyl)prop-2-en-1-amine.
| Compound Name | (E)-2,3-dichloro-N-(2-prop-2-ynylsulfanylethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 106428542 |
| Molecular Formula | C8H11Cl2NS |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | (E)-2,3-dichloro-N-(2-prop-2-ynylsulfanylethyl)prop-2-en-1-amine |
| SMILES | C#CCSCCNC/C(Cl)=C\Cl |
| InChI | InChI=1S/C8H11Cl2NS/c1-2-4-12-5-3-11-7-8(10)6-9/h1,6,11H,3-5,7H2/b8-6+ |
| InChIKey | NRENCVQWNWCOCU-SOFGYWHQSA-N |
| XLogP | 2.26 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|