C9H14ClNS — CID 106438377
3-chloro-2-methyl-N-(2-prop-2-ynylsulfanylethyl)prop-2-en-1-amine (PubChem CID 106438377) has the molecular formula C9H14ClNS and a molecular weight of 203.74 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(2-prop-2-ynylsulfanylethyl)prop-2-en-1-amine.
| Compound Name | 3-chloro-2-methyl-N-(2-prop-2-ynylsulfanylethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 106438377 |
| Molecular Formula | C9H14ClNS |
| Molecular Weight | 203.74 g/mol |
| Exact Mass | 203.05 |
| IUPAC Name | 3-chloro-2-methyl-N-(2-prop-2-ynylsulfanylethyl)prop-2-en-1-amine |
| SMILES | C#CCSCCNCC(C)=CCl |
| InChI | InChI=1S/C9H14ClNS/c1-3-5-12-6-4-11-8-9(2)7-10/h1,7,11H,4-6,8H2,2H3 |
| InChIKey | UMQZVQBNGTZNKA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|