C18H14N2O7 — CID 10642881
7-[(3,5-dinitrophenyl)methoxy]-3,4-dimethylchromen-2-one (PubChem CID 10642881) has the molecular formula C18H14N2O7 and a molecular weight of 370.32 g/mol. Its IUPAC name is 7-[(3,5-dinitrophenyl)methoxy]-3,4-dimethylchromen-2-one.
| Compound Name | 7-[(3,5-dinitrophenyl)methoxy]-3,4-dimethylchromen-2-one |
|---|---|
| PubChem CID | 10642881 |
| Molecular Formula | C18H14N2O7 |
| Molecular Weight | 370.32 g/mol |
| Exact Mass | 370.08 |
| IUPAC Name | 7-[(3,5-dinitrophenyl)methoxy]-3,4-dimethylchromen-2-one |
| SMILES | Cc1c(C)c2ccc(OCc3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)cc2oc1=O |
| InChI | InChI=1S/C18H14N2O7/c1-10-11(2)18(21)27-17-8-15(3-4-16(10)17)26-9-12-5-13(19(22)23)7-14(6-12)20(24)25/h3-8H,9H2,1-2H3 |
| InChIKey | DQTHWPVVIBFRCG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 125.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|