C8H9F3N4S2 — CID 106428950
3-[2-(trifluoromethylsulfanyl)ethylamino]pyridazine-4-carbothioamide (PubChem CID 106428950) has the molecular formula C8H9F3N4S2 and a molecular weight of 282.32 g/mol. Its IUPAC name is 3-[2-(trifluoromethylsulfanyl)ethylamino]pyridazine-4-carbothioamide.
| Compound Name | 3-[2-(trifluoromethylsulfanyl)ethylamino]pyridazine-4-carbothioamide |
|---|---|
| PubChem CID | 106428950 |
| Molecular Formula | C8H9F3N4S2 |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 3-[2-(trifluoromethylsulfanyl)ethylamino]pyridazine-4-carbothioamide |
| SMILES | NC(=S)c1ccnnc1NCCSC(F)(F)F |
| InChI | InChI=1S/C8H9F3N4S2/c9-8(10,11)17-4-3-13-7-5(6(12)16)1-2-14-15-7/h1-2H,3-4H2,(H2,12,16)(H,13,15) |
| InChIKey | CGAVZDGTXNRRQE-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|