C9H16N4 — CID 46848812
4-(aminomethyl)-N-butylpyridazin-3-amine (PubChem CID 46848812) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 4-(aminomethyl)-N-butylpyridazin-3-amine.
| Compound Name | 4-(aminomethyl)-N-butylpyridazin-3-amine |
|---|---|
| PubChem CID | 46848812 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 4-(aminomethyl)-N-butylpyridazin-3-amine |
| SMILES | CCCCNc1nnccc1CN |
| InChI | InChI=1S/C9H16N4/c1-2-3-5-11-9-8(7-10)4-6-12-13-9/h4,6H,2-3,5,7,10H2,1H3,(H,11,13) |
| InChIKey | GHLVNGAIGCGSOM-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|