C8H14F3NO3S — CID 106429028
methyl 2-hydroxy-2-methyl-3-[2-(trifluoromethylsulfanyl)ethylamino]propanoate (PubChem CID 106429028) has the molecular formula C8H14F3NO3S and a molecular weight of 261.26 g/mol. Its IUPAC name is methyl 2-hydroxy-2-methyl-3-[2-(trifluoromethylsulfanyl)ethylamino]propanoate.
| Compound Name | methyl 2-hydroxy-2-methyl-3-[2-(trifluoromethylsulfanyl)ethylamino]propanoate |
|---|---|
| PubChem CID | 106429028 |
| Molecular Formula | C8H14F3NO3S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | methyl 2-hydroxy-2-methyl-3-[2-(trifluoromethylsulfanyl)ethylamino]propanoate |
| SMILES | COC(=O)C(C)(O)CNCCSC(F)(F)F |
| InChI | InChI=1S/C8H14F3NO3S/c1-7(14,6(13)15-2)5-12-3-4-16-8(9,10)11/h12,14H,3-5H2,1-2H3 |
| InChIKey | TZSYWEMUXAGPTP-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|