C12H10F3N3O2S — CID 106429595
4-[2-(trifluoromethylsulfanyl)ethylamino]quinazoline-7-carboxylic acid (PubChem CID 106429595) has the molecular formula C12H10F3N3O2S and a molecular weight of 317.29 g/mol. Its IUPAC name is 4-[2-(trifluoromethylsulfanyl)ethylamino]quinazoline-7-carboxylic acid.
| Compound Name | 4-[2-(trifluoromethylsulfanyl)ethylamino]quinazoline-7-carboxylic acid |
|---|---|
| PubChem CID | 106429595 |
| Molecular Formula | C12H10F3N3O2S |
| Molecular Weight | 317.29 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 4-[2-(trifluoromethylsulfanyl)ethylamino]quinazoline-7-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(NCCSC(F)(F)F)ncnc2c1 |
| InChI | InChI=1S/C12H10F3N3O2S/c13-12(14,15)21-4-3-16-10-8-2-1-7(11(19)20)5-9(8)17-6-18-10/h1-2,5-6H,3-4H2,(H,19,20)(H,16,17,18) |
| InChIKey | WZJNFERBBXRYIP-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.29 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|