C15H30N2S — CID 106429737
2,3-dimethyl-1-(2-prop-2-enylsulfanylethyl)-N-propylpiperidin-4-amine (PubChem CID 106429737) has the molecular formula C15H30N2S and a molecular weight of 270.49 g/mol. Its IUPAC name is 2,3-dimethyl-1-(2-prop-2-enylsulfanylethyl)-N-propylpiperidin-4-amine.
| Compound Name | 2,3-dimethyl-1-(2-prop-2-enylsulfanylethyl)-N-propylpiperidin-4-amine |
|---|---|
| PubChem CID | 106429737 |
| Molecular Formula | C15H30N2S |
| Molecular Weight | 270.49 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2,3-dimethyl-1-(2-prop-2-enylsulfanylethyl)-N-propylpiperidin-4-amine |
| SMILES | C=CCSCCN1CCC(NCCC)C(C)C1C |
| InChI | InChI=1S/C15H30N2S/c1-5-8-16-15-7-9-17(14(4)13(15)3)10-12-18-11-6-2/h6,13-16H,2,5,7-12H2,1,3-4H3 |
| InChIKey | DZEFRMGNPMCWRY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|