C14H15BrN2O2S2 — CID 106431568
2-[5-bromo-1-(2-prop-2-enylsulfanylethyl)benzimidazol-2-yl]sulfanylacetic acid (PubChem CID 106431568) has the molecular formula C14H15BrN2O2S2 and a molecular weight of 387.32 g/mol. Its IUPAC name is 2-[5-bromo-1-(2-prop-2-enylsulfanylethyl)benzimidazol-2-yl]sulfanylacetic acid.
| Compound Name | 2-[5-bromo-1-(2-prop-2-enylsulfanylethyl)benzimidazol-2-yl]sulfanylacetic acid |
|---|---|
| PubChem CID | 106431568 |
| Molecular Formula | C14H15BrN2O2S2 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 2-[5-bromo-1-(2-prop-2-enylsulfanylethyl)benzimidazol-2-yl]sulfanylacetic acid |
| SMILES | C=CCSCCn1c(SCC(=O)O)nc2cc(Br)ccc21 |
| InChI | InChI=1S/C14H15BrN2O2S2/c1-2-6-20-7-5-17-12-4-3-10(15)8-11(12)16-14(17)21-9-13(18)19/h2-4,8H,1,5-7,9H2,(H,18,19) |
| InChIKey | PGHHAJMWKOMXCC-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|