C19H21NO7 — CID 10643179
dimethyl (3S,6S)-6-[(4-methoxyphenyl)-methylcarbamoyl]-1-oxaspiro[2.4]hept-4-ene-4,5-dicarboxylate (PubChem CID 10643179) has the molecular formula C19H21NO7 and a molecular weight of 375.38 g/mol. Its IUPAC name is dimethyl (3S,6S)-6-[(4-methoxyphenyl)-methylcarbamoyl]-1-oxaspiro[2.4]hept-4-ene-4,5-dicarboxylate.
| Compound Name | dimethyl (3S,6S)-6-[(4-methoxyphenyl)-methylcarbamoyl]-1-oxaspiro[2.4]hept-4-ene-4,5-dicarboxylate |
|---|---|
| PubChem CID | 10643179 |
| Molecular Formula | C19H21NO7 |
| Molecular Weight | 375.38 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | dimethyl (3S,6S)-6-[(4-methoxyphenyl)-methylcarbamoyl]-1-oxaspiro[2.4]hept-4-ene-4,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C(=O)OC)[C@]2(CO2)C[C@@H]1C(=O)N(C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H21NO7/c1-20(11-5-7-12(24-2)8-6-11)16(21)13-9-19(10-27-19)15(18(23)26-4)14(13)17(22)25-3/h5-8,13H,9-10H2,1-4H3/t13-,19+/m0/s1 |
| InChIKey | ICJLQYWWHGXKSR-ORAYPTAESA-N |
| XLogP | 1.09 |
| TPSA | 94.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.38 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|