C23H22N2O5 — CID 10740095
(4S,6S)-N-(4-methoxyphenyl)-N-methyl-1,3-dioxo-2-phenylspiro[3a,5,6,6a-tetrahydrocyclopenta[c]pyrrole-4,2'-oxirane]-6-carboxamide (PubChem CID 10740095) has the molecular formula C23H22N2O5 and a molecular weight of 406.44 g/mol. Its IUPAC name is (4S,6S)-N-(4-methoxyphenyl)-N-methyl-1,3-dioxo-2-phenylspiro[3a,5,6,6a-tetrahydrocyclopenta[c]pyrrole-4,2'-oxirane]-6-carboxamide.
| Compound Name | (4S,6S)-N-(4-methoxyphenyl)-N-methyl-1,3-dioxo-2-phenylspiro[3a,5,6,6a-tetrahydrocyclopenta[c]pyrrole-4,2'-oxirane]-6-carboxamide |
|---|---|
| PubChem CID | 10740095 |
| Molecular Formula | C23H22N2O5 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | (4S,6S)-N-(4-methoxyphenyl)-N-methyl-1,3-dioxo-2-phenylspiro[3a,5,6,6a-tetrahydrocyclopenta[c]pyrrole-4,2'-oxirane]-6-carboxamide |
| SMILES | COc1ccc(N(C)C(=O)[C@H]2C[C@@]3(CO3)C3C(=O)N(c4ccccc4)C(=O)C32)cc1 |
| InChI | InChI=1S/C23H22N2O5/c1-24(14-8-10-16(29-2)11-9-14)20(26)17-12-23(13-30-23)19-18(17)21(27)25(22(19)28)15-6-4-3-5-7-15/h3-11,17-19H,12-13H2,1-2H3/t17-,18?,19?,23+/m0/s1 |
| InChIKey | IDVQLIPDCBUFTJ-QIKFBPPQSA-N |
| XLogP | 2.25 |
| TPSA | 79.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|