C13H16ClNOS — CID 106432202
2-chloro-1-[2,5-dimethyl-1-(2-prop-2-ynylsulfanylethyl)pyrrol-3-yl]ethanone (PubChem CID 106432202) has the molecular formula C13H16ClNOS and a molecular weight of 269.80 g/mol. Its IUPAC name is 2-chloro-1-[2,5-dimethyl-1-(2-prop-2-ynylsulfanylethyl)pyrrol-3-yl]ethanone.
| Compound Name | 2-chloro-1-[2,5-dimethyl-1-(2-prop-2-ynylsulfanylethyl)pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 106432202 |
| Molecular Formula | C13H16ClNOS |
| Molecular Weight | 269.80 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 2-chloro-1-[2,5-dimethyl-1-(2-prop-2-ynylsulfanylethyl)pyrrol-3-yl]ethanone |
| SMILES | C#CCSCCn1c(C)cc(C(=O)CCl)c1C |
| InChI | InChI=1S/C13H16ClNOS/c1-4-6-17-7-5-15-10(2)8-12(11(15)3)13(16)9-14/h1,8H,5-7,9H2,2-3H3 |
| InChIKey | FHNUDWHVFHDOHZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.80 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|