C9H11F3N2O2S2 — CID 106432552
ethyl 5-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazole-4-carboxylate (PubChem CID 106432552) has the molecular formula C9H11F3N2O2S2 and a molecular weight of 300.33 g/mol. Its IUPAC name is ethyl 5-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 5-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 106432552 |
| Molecular Formula | C9H11F3N2O2S2 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | ethyl 5-[2-(trifluoromethylsulfanyl)ethylamino]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncsc1NCCSC(F)(F)F |
| InChI | InChI=1S/C9H11F3N2O2S2/c1-2-16-8(15)6-7(17-5-14-6)13-3-4-18-9(10,11)12/h5,13H,2-4H2,1H3 |
| InChIKey | BWHHSJMBXZKAMI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|