C14H26N2S — CID 106432738
3-(2-methylpropyl)-1-(2-prop-2-ynylsulfanylethyl)-1,4-diazepane (PubChem CID 106432738) has the molecular formula C14H26N2S and a molecular weight of 254.44 g/mol. Its IUPAC name is 3-(2-methylpropyl)-1-(2-prop-2-ynylsulfanylethyl)-1,4-diazepane.
| Compound Name | 3-(2-methylpropyl)-1-(2-prop-2-ynylsulfanylethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 106432738 |
| Molecular Formula | C14H26N2S |
| Molecular Weight | 254.44 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 3-(2-methylpropyl)-1-(2-prop-2-ynylsulfanylethyl)-1,4-diazepane |
| SMILES | C#CCSCCN1CCCNC(CC(C)C)C1 |
| InChI | InChI=1S/C14H26N2S/c1-4-9-17-10-8-16-7-5-6-15-14(12-16)11-13(2)3/h1,13-15H,5-12H2,2-3H3 |
| InChIKey | YWWNKIJLDBOWOC-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.44 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|