C12H25FN2 — CID 81113598
1-(3-fluoropropyl)-3-(2-methylpropyl)-1,4-diazepane (PubChem CID 81113598) has the molecular formula C12H25FN2 and a molecular weight of 216.34 g/mol. Its IUPAC name is 1-(3-fluoropropyl)-3-(2-methylpropyl)-1,4-diazepane.
| Compound Name | 1-(3-fluoropropyl)-3-(2-methylpropyl)-1,4-diazepane |
|---|---|
| PubChem CID | 81113598 |
| Molecular Formula | C12H25FN2 |
| Molecular Weight | 216.34 g/mol |
| Exact Mass | 216.20 |
| IUPAC Name | 1-(3-fluoropropyl)-3-(2-methylpropyl)-1,4-diazepane |
| SMILES | CC(C)CC1CN(CCCF)CCCN1 |
| InChI | InChI=1S/C12H25FN2/c1-11(2)9-12-10-15(7-3-5-13)8-4-6-14-12/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | DEPMPIYQFASGBN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.34 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |