C16H28N2O2S — CID 106432930
3-(2-methylpropyl)-6-propan-2-yl-1-(2-prop-2-enylsulfanylethyl)piperazine-2,5-dione (PubChem CID 106432930) has the molecular formula C16H28N2O2S and a molecular weight of 312.48 g/mol. Its IUPAC name is 3-(2-methylpropyl)-6-propan-2-yl-1-(2-prop-2-enylsulfanylethyl)piperazine-2,5-dione.
| Compound Name | 3-(2-methylpropyl)-6-propan-2-yl-1-(2-prop-2-enylsulfanylethyl)piperazine-2,5-dione |
|---|---|
| PubChem CID | 106432930 |
| Molecular Formula | C16H28N2O2S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 3-(2-methylpropyl)-6-propan-2-yl-1-(2-prop-2-enylsulfanylethyl)piperazine-2,5-dione |
| SMILES | C=CCSCCN1C(=O)C(CC(C)C)NC(=O)C1C(C)C |
| InChI | InChI=1S/C16H28N2O2S/c1-6-8-21-9-7-18-14(12(4)5)15(19)17-13(16(18)20)10-11(2)3/h6,11-14H,1,7-10H2,2-5H3,(H,17,19) |
| InChIKey | RGJGUVGQMPJBGY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|