C11H17F3N4OS2 — CID 106434208
4-amino-2-[methyl(propyl)amino]-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3-thiazole-5-carboxamide (PubChem CID 106434208) has the molecular formula C11H17F3N4OS2 and a molecular weight of 342.41 g/mol. Its IUPAC name is 4-amino-2-[methyl(propyl)amino]-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-[methyl(propyl)amino]-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 106434208 |
| Molecular Formula | C11H17F3N4OS2 |
| Molecular Weight | 342.41 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-amino-2-[methyl(propyl)amino]-N-[2-(trifluoromethylsulfanyl)ethyl]-1,3-thiazole-5-carboxamide |
| SMILES | CCCN(C)c1nc(N)c(C(=O)NCCSC(F)(F)F)s1 |
| InChI | InChI=1S/C11H17F3N4OS2/c1-3-5-18(2)10-17-8(15)7(21-10)9(19)16-4-6-20-11(12,13)14/h3-6,15H2,1-2H3,(H,16,19) |
| InChIKey | PMCYKCVZQOTXEU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|