C11H21N5O3S2 — CID 116664858
4-amino-2-[methyl(propyl)amino]-N-(3-sulfamoylpropyl)-1,3-thiazole-5-carboxamide (PubChem CID 116664858) has the molecular formula C11H21N5O3S2 and a molecular weight of 335.46 g/mol. Its IUPAC name is 4-amino-2-[methyl(propyl)amino]-N-(3-sulfamoylpropyl)-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-2-[methyl(propyl)amino]-N-(3-sulfamoylpropyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116664858 |
| Molecular Formula | C11H21N5O3S2 |
| Molecular Weight | 335.46 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 4-amino-2-[methyl(propyl)amino]-N-(3-sulfamoylpropyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCN(C)c1nc(N)c(C(=O)NCCCS(N)(=O)=O)s1 |
| InChI | InChI=1S/C11H21N5O3S2/c1-3-6-16(2)11-15-9(12)8(20-11)10(17)14-5-4-7-21(13,18)19/h3-7,12H2,1-2H3,(H,14,17)(H2,13,18,19) |
| InChIKey | YXMGZNDTBJTFAU-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 131.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.46 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|