C14H27N5OS — CID 116668561
4-amino-N-[3-(diethylamino)propyl]-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxamide (PubChem CID 116668561) has the molecular formula C14H27N5OS and a molecular weight of 313.47 g/mol. Its IUPAC name is 4-amino-N-[3-(diethylamino)propyl]-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxamide.
| Compound Name | 4-amino-N-[3-(diethylamino)propyl]-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 116668561 |
| Molecular Formula | C14H27N5OS |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 4-amino-N-[3-(diethylamino)propyl]-2-[ethyl(methyl)amino]-1,3-thiazole-5-carboxamide |
| SMILES | CCN(CC)CCCNC(=O)c1sc(N(C)CC)nc1N |
| InChI | InChI=1S/C14H27N5OS/c1-5-18(4)14-17-12(15)11(21-14)13(20)16-9-8-10-19(6-2)7-3/h5-10,15H2,1-4H3,(H,16,20) |
| InChIKey | DUQXJZGLXFBZTJ-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|