C23H32N4O — CID 10643521
2-N-(1-benzylpiperidin-4-yl)-3-N-(1-ethoxycyclopropyl)-2-N-methylpyridine-2,3-diamine (PubChem CID 10643521) has the molecular formula C23H32N4O and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-N-(1-benzylpiperidin-4-yl)-3-N-(1-ethoxycyclopropyl)-2-N-methylpyridine-2,3-diamine.
| Compound Name | 2-N-(1-benzylpiperidin-4-yl)-3-N-(1-ethoxycyclopropyl)-2-N-methylpyridine-2,3-diamine |
|---|---|
| PubChem CID | 10643521 |
| Molecular Formula | C23H32N4O |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.26 |
| IUPAC Name | 2-N-(1-benzylpiperidin-4-yl)-3-N-(1-ethoxycyclopropyl)-2-N-methylpyridine-2,3-diamine |
| SMILES | CCOC1(Nc2cccnc2N(C)C2CCN(Cc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C23H32N4O/c1-3-28-23(13-14-23)25-21-10-7-15-24-22(21)26(2)20-11-16-27(17-12-20)18-19-8-5-4-6-9-19/h4-10,15,20,25H,3,11-14,16-18H2,1-2H3 |
| InChIKey | MGKQPILCIKYYAO-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|